C19H25NO2 — CID 146161975
(9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-2(6)-ene-3,18-dione (PubChem CID 146161975) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-2(6)-ene-3,18-dione.
| Compound Name | (9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-2(6)-ene-3,18-dione |
|---|---|
| PubChem CID | 146161975 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-2(6)-ene-3,18-dione |
| SMILES | C[C@@H]1CN2C[C@H]3CCC4=C(C(=O)CC4)C4C(=O)C1CC2[C@]43C |
| InChI | InChI=1S/C19H25NO2/c1-10-8-20-9-12-5-3-11-4-6-14(21)16(11)17-18(22)13(10)7-15(20)19(12,17)2/h10,12-13,15,17H,3-9H2,1-2H3/t10-,12-,13?,15?,17?,19-/m1/s1 |
| InChIKey | LTKCYHWHZGDDBZ-UBKRYBTESA-N |
| XLogP | 2.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |