About CID 146162012
CID 146162012 (PubChem CID 146162012) has the molecular formula C8H8NS
and a molecular weight of 150.23 g/mol.
Molecular Properties
| Compound Name | CID 146162012 |
| PubChem CID | 146162012 |
| Molecular Formula | C8H8NS |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | — |
| SMILES | CC1=N[C]2C=CC=CC2S1 |
| InChI | InChI=1S/C8H8NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5,8H,1H3 |
| InChIKey | CXXLZYRRJIHGTA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 146162012 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146162012?
The IUPAC name of CID 146162012 (CID 146162012) is not available.
What is the SMILES notation for CID 146162012?
The canonical SMILES for CID 146162012 is CC1=N[C]2C=CC=CC2S1.
What is the InChIKey of CID 146162012?
The InChIKey is CXXLZYRRJIHGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5,8H,1H3.
What are the key properties of CID 146162012?
CID 146162012 has a molecular weight of 150.23 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146162012 is sourced from PubChem (CID 146162012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).