About (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one
(1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one (PubChem CID 146162040) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one.
Molecular Properties
| Compound Name | (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one |
| PubChem CID | 146162040 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one |
| SMILES | O=C1CC2C[C@]3(CCCN13)CC[C@@H]2O |
| InChI | InChI=1S/C11H17NO2/c13-9-2-4-11-3-1-5-12(11)10(14)6-8(9)7-11/h8-9,13H,1-7H2/t8?,9-,11-/m0/s1 |
| InChIKey | AOMFMKGPRSZHNS-PCFYAGROSA-N |
| XLogP | 0.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one?
The IUPAC name of (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one (CID 146162040) is (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one.
What is the SMILES notation for (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one?
The canonical SMILES for (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one is O=C1CC2C[C@]3(CCCN13)CC[C@@H]2O.
What is the InChIKey of (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one?
The InChIKey is AOMFMKGPRSZHNS-PCFYAGROSA-N. The full InChI is InChI=1S/C11H17NO2/c13-9-2-4-11-3-1-5-12(11)10(14)6-8(9)7-11/h8-9,13H,1-7H2/t8?,9-,11-/m0/s1.
What are the key properties of (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one?
(1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one has a molecular weight of 195.26 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,9S)-9-hydroxy-5-azatricyclo[6.3.1.01,5]dodecan-6-one is sourced from PubChem (CID 146162040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).