About CID 146162086
CID 146162086 (PubChem CID 146162086) has the molecular formula C13H10NO
and a molecular weight of 196.23 g/mol.
Molecular Properties
| Compound Name | CID 146162086 |
| PubChem CID | 146162086 |
| Molecular Formula | C13H10NO |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | — |
| SMILES | C1=CC2=N[C](c3ccccc3)OC2C=C1 |
| InChI | InChI=1S/C13H10NO/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9,12H |
| InChIKey | NATAVARFRZCOMU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 146162086 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146162086?
The IUPAC name of CID 146162086 (CID 146162086) is not available.
What is the SMILES notation for CID 146162086?
The canonical SMILES for CID 146162086 is C1=CC2=N[C](c3ccccc3)OC2C=C1.
What is the InChIKey of CID 146162086?
The InChIKey is NATAVARFRZCOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10NO/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9,12H.
What are the key properties of CID 146162086?
CID 146162086 has a molecular weight of 196.23 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146162086 is sourced from PubChem (CID 146162086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).