About N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide
N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide (PubChem CID 146162150) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide |
| PubChem CID | 146162150 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1cc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C12H18N2O/c1-7-6-12(10(4)13-11(5)15)14-9(3)8(7)2/h6,10H,1-5H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | OHMVRQDWWWGHOJ-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide?
The IUPAC name of N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide (CID 146162150) is N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide.
What is the SMILES notation for N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide?
The canonical SMILES for N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide is CC(=O)N[C@@H](C)c1cc(C)c(C)c(C)n1.
What is the InChIKey of N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide?
The InChIKey is OHMVRQDWWWGHOJ-JTQLQIEISA-N. The full InChI is InChI=1S/C12H18N2O/c1-7-6-12(10(4)13-11(5)15)14-9(3)8(7)2/h6,10H,1-5H3,(H,13,15)/t10-/m0/s1.
What are the key properties of N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide?
N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide has a molecular weight of 206.29 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(4,5,6-trimethyl-2-pyridinyl)ethyl]acetamide is sourced from PubChem (CID 146162150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).