C9H14FNO2 — CID 146162180
methyl (1R)-1-fluoro-8-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 146162180) has the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. Its IUPAC name is methyl (1R)-1-fluoro-8-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl (1R)-1-fluoro-8-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 146162180 |
| Molecular Formula | C9H14FNO2 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | methyl (1R)-1-fluoro-8-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | COC(=O)C1CC2CC[C@@](F)(C1)N2 |
| InChI | InChI=1S/C9H14FNO2/c1-13-8(12)6-4-7-2-3-9(10,5-6)11-7/h6-7,11H,2-5H2,1H3/t6?,7?,9-/m0/s1 |
| InChIKey | VRQTZYPNNNOMAU-IEIXJENWSA-N |
| XLogP | 0.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|