C21H31NO3Si — CID 146162340
(4R)-4-benzyl-3-[(1E)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbuta-1,3-dienyl]-1,3-oxazolidin-2-one (PubChem CID 146162340) has the molecular formula C21H31NO3Si and a molecular weight of 373.57 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(1E)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbuta-1,3-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(1E)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbuta-1,3-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146162340 |
| Molecular Formula | C21H31NO3Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (4R)-4-benzyl-3-[(1E)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbuta-1,3-dienyl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C(C)=C(/O[Si](C)(C)C(C)(C)C)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO3Si/c1-8-16(2)19(25-26(6,7)21(3,4)5)22-18(15-24-20(22)23)14-17-12-10-9-11-13-17/h8-13,18H,1,14-15H2,2-7H3/b19-16+/t18-/m1/s1 |
| InChIKey | LDAUNFGJLKHFDP-CQGUWYRNSA-N |
| XLogP | 5.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|