C18H20N2O4 — CID 146162424
N-[(1R,2S,6S,7S,8S)-4-methyl-3,5-dioxo-8-phenyl-9-oxa-4-azatricyclo[5.4.0.02,6]undecan-1-yl]acetamide (PubChem CID 146162424) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[(1R,2S,6S,7S,8S)-4-methyl-3,5-dioxo-8-phenyl-9-oxa-4-azatricyclo[5.4.0.02,6]undecan-1-yl]acetamide.
| Compound Name | N-[(1R,2S,6S,7S,8S)-4-methyl-3,5-dioxo-8-phenyl-9-oxa-4-azatricyclo[5.4.0.02,6]undecan-1-yl]acetamide |
|---|---|
| PubChem CID | 146162424 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[(1R,2S,6S,7S,8S)-4-methyl-3,5-dioxo-8-phenyl-9-oxa-4-azatricyclo[5.4.0.02,6]undecan-1-yl]acetamide |
| SMILES | CC(=O)N[C@]12CCO[C@H](c3ccccc3)[C@H]1[C@@H]1C(=O)N(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H20N2O4/c1-10(21)19-18-8-9-24-15(11-6-4-3-5-7-11)13(18)12-14(18)17(23)20(2)16(12)22/h3-7,12-15H,8-9H2,1-2H3,(H,19,21)/t12-,13+,14+,15+,18+/m0/s1 |
| InChIKey | LVOZZPNZUUWPEL-BHDXSGHGSA-N |
| XLogP | 0.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|