C44H32FNO — CID 146162588
1-(4-fluoro-5,6,7,8-tetraphenylnaphthalen-1-yl)-3,3-dimethylindol-2-one (PubChem CID 146162588) has the molecular formula C44H32FNO and a molecular weight of 609.74 g/mol. Its IUPAC name is 1-(4-fluoro-5,6,7,8-tetraphenylnaphthalen-1-yl)-3,3-dimethylindol-2-one.
| Compound Name | 1-(4-fluoro-5,6,7,8-tetraphenylnaphthalen-1-yl)-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 146162588 |
| Molecular Formula | C44H32FNO |
| Molecular Weight | 609.74 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 1-(4-fluoro-5,6,7,8-tetraphenylnaphthalen-1-yl)-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N(c2ccc(F)c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c23)c2ccccc21 |
| InChI | InChI=1S/C44H32FNO/c1-44(2)33-25-15-16-26-35(33)46(43(44)47)36-28-27-34(45)41-39(31-21-11-5-12-22-31)37(29-17-7-3-8-18-29)38(30-19-9-4-10-20-30)40(42(36)41)32-23-13-6-14-24-32/h3-28H,1-2H3 |
| InChIKey | OSHAEXFBAXLFES-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.74 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |