C32H37NO6Si — CID 146162732
trimethyl-[2-[(2S,5R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl]silane (PubChem CID 146162732) has the molecular formula C32H37NO6Si and a molecular weight of 559.74 g/mol. Its IUPAC name is trimethyl-[2-[(2S,5R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(2S,5R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 146162732 |
| Molecular Formula | C32H37NO6Si |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | trimethyl-[2-[(2S,5R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#C[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C32H37NO6Si/c1-40(2,3)20-19-28-30(33(34)35)32(38-23-27-17-11-6-12-18-27)31(37-22-26-15-9-5-10-16-26)29(39-28)24-36-21-25-13-7-4-8-14-25/h4-18,28-32H,21-24H2,1-3H3/t28-,29?,30?,31-,32?/m0/s1 |
| InChIKey | PENOOWKHUDBIPL-YMTJEZOSSA-N |
| XLogP | 5.67 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|