C33H60O4Si2 — CID 146162789
methyl (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenoate (PubChem CID 146162789) has the molecular formula C33H60O4Si2 and a molecular weight of 577.01 g/mol. Its IUPAC name is methyl (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenoate.
| Compound Name | methyl (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 146162789 |
| Molecular Formula | C33H60O4Si2 |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | methyl (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenoate |
| SMILES | CC[C@H](/C=C/C=C\C/C=C\C/C=C\C=C\[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H60O4Si2/c1-13-29(36-38(9,10)32(2,3)4)25-22-20-18-16-14-15-17-19-21-23-26-30(27-24-28-31(34)35-8)37-39(11,12)33(5,6)7/h14-15,18-23,25-26,29-30H,13,16-17,24,27-28H2,1-12H3/b15-14-,20-18-,21-19-,25-22+,26-23+/t29-,30-/m1/s1 |
| InChIKey | GDKUCHAMSHTKBH-YESQHXFSSA-N |
| XLogP | 10.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|