About N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate
N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate (PubChem CID 146162800) has the molecular formula C16H15N2O-
and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate.
Molecular Properties
| Compound Name | N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate |
| PubChem CID | 146162800 |
| Molecular Formula | C16H15N2O- |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate |
| SMILES | C=Cc1ccccc1N(C)/C([O-])=N/c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c1-3-13-9-7-8-12-15(13)18(2)16(19)17-14-10-5-4-6-11-14/h3-12H,1H2,2H3,(H,17,19)/p-1 |
| InChIKey | JCDXQFYBIZWWCU-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate?
The IUPAC name of N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate (CID 146162800) is N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate.
What is the SMILES notation for N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate?
The canonical SMILES for N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate is C=Cc1ccccc1N(C)/C([O-])=N/c1ccccc1.
What is the InChIKey of N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate?
The InChIKey is JCDXQFYBIZWWCU-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16N2O/c1-3-13-9-7-8-12-15(13)18(2)16(19)17-14-10-5-4-6-11-14/h3-12H,1H2,2H3,(H,17,19)/p-1.
What are the key properties of N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate?
N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate has a molecular weight of 251.31 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethenylphenyl)-N-methyl-N'-phenylcarbamimidate is sourced from PubChem (CID 146162800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).