C23H18N2O5S — CID 146162874
4-methyl-N-[(3R)-1'-methyl-2,2'-dioxospiro[1-benzofuran-3,3'-indole]-5-yl]benzenesulfonamide (PubChem CID 146162874) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is 4-methyl-N-[(3R)-1'-methyl-2,2'-dioxospiro[1-benzofuran-3,3'-indole]-5-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3R)-1'-methyl-2,2'-dioxospiro[1-benzofuran-3,3'-indole]-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 146162874 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-methyl-N-[(3R)-1'-methyl-2,2'-dioxospiro[1-benzofuran-3,3'-indole]-5-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)[C@@]2(C(=O)O3)C(=O)N(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H18N2O5S/c1-14-7-10-16(11-8-14)31(28,29)24-15-9-12-20-18(13-15)23(22(27)30-20)17-5-3-4-6-19(17)25(2)21(23)26/h3-13,24H,1-2H3/t23-/m1/s1 |
| InChIKey | BJJUONJHMIBKEG-HSZRJFAPSA-N |
| XLogP | 2.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|