C18H20F2N2O2 — CID 146163172
tert-butyl N-[4-(2,2-difluoro-2-pyridin-2-ylethyl)phenyl]carbamate (PubChem CID 146163172) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is tert-butyl N-[4-(2,2-difluoro-2-pyridin-2-ylethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,2-difluoro-2-pyridin-2-ylethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 146163172 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | tert-butyl N-[4-(2,2-difluoro-2-pyridin-2-ylethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CC(F)(F)c2ccccn2)cc1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-17(2,3)24-16(23)22-14-9-7-13(8-10-14)12-18(19,20)15-6-4-5-11-21-15/h4-11H,12H2,1-3H3,(H,22,23) |
| InChIKey | YTEQCMBDGRJQNT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |