C17H17NO5 — CID 146163230
ethyl (3aR,6aS)-5-benzyl-2-methyl-4,6-dioxo-3a,6a-dihydrofuro[2,3-c]pyrrole-3-carboxylate (PubChem CID 146163230) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is ethyl (3aR,6aS)-5-benzyl-2-methyl-4,6-dioxo-3a,6a-dihydrofuro[2,3-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (3aR,6aS)-5-benzyl-2-methyl-4,6-dioxo-3a,6a-dihydrofuro[2,3-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 146163230 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl (3aR,6aS)-5-benzyl-2-methyl-4,6-dioxo-3a,6a-dihydrofuro[2,3-c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H17NO5/c1-3-22-17(21)12-10(2)23-14-13(12)15(19)18(16(14)20)9-11-7-5-4-6-8-11/h4-8,13-14H,3,9H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | FOUQJHWVNAAARZ-KGLIPLIRSA-N |
| XLogP | 1.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|