C16H11F3N2O4 — CID 146163255
ethyl (1S,5R)-6-cyano-2,4-dioxo-3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 146163255) has the molecular formula C16H11F3N2O4 and a molecular weight of 352.27 g/mol. Its IUPAC name is ethyl (1S,5R)-6-cyano-2,4-dioxo-3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl (1S,5R)-6-cyano-2,4-dioxo-3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 146163255 |
| Molecular Formula | C16H11F3N2O4 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | ethyl (1S,5R)-6-cyano-2,4-dioxo-3-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)C1(C#N)[C@@H]2C(=O)N(c3ccc(C(F)(F)F)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C16H11F3N2O4/c1-2-25-14(24)15(7-20)10-11(15)13(23)21(12(10)22)9-5-3-8(4-6-9)16(17,18)19/h3-6,10-11H,2H2,1H3/t10-,11+,15? |
| InChIKey | QEOMPKCWSZAONH-YWXMQNBFSA-N |
| XLogP | 1.90 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|