C15H11FN2O4 — CID 146163261
ethyl (1S,5R)-6-cyano-3-(2-fluorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 146163261) has the molecular formula C15H11FN2O4 and a molecular weight of 302.26 g/mol. Its IUPAC name is ethyl (1S,5R)-6-cyano-3-(2-fluorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl (1S,5R)-6-cyano-3-(2-fluorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 146163261 |
| Molecular Formula | C15H11FN2O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | ethyl (1S,5R)-6-cyano-3-(2-fluorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)C1(C#N)[C@@H]2C(=O)N(c3ccccc3F)C(=O)[C@@H]21 |
| InChI | InChI=1S/C15H11FN2O4/c1-2-22-14(21)15(7-17)10-11(15)13(20)18(12(10)19)9-6-4-3-5-8(9)16/h3-6,10-11H,2H2,1H3/t10-,11+,15? |
| InChIKey | UDWGFADEWZWUML-YWXMQNBFSA-N |
| XLogP | 1.02 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|