C22H40O4Si — CID 146163425
ethyl 2-[(4R,4aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-methyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-yl]acetate (PubChem CID 146163425) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is ethyl 2-[(4R,4aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-methyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[(4R,4aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-methyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 146163425 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl 2-[(4R,4aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hydroxy-4-methyl-3,4,4a,5,6,8a-hexahydro-2H-naphthalen-1-yl]acetate |
| SMILES | CCOC(=O)CC1(O)CC[C@@H](C)[C@@H]2CCC(CO[Si](C)(C)C(C)(C)C)=CC21 |
| InChI | InChI=1S/C22H40O4Si/c1-8-25-20(23)14-22(24)12-11-16(2)18-10-9-17(13-19(18)22)15-26-27(6,7)21(3,4)5/h13,16,18-19,24H,8-12,14-15H2,1-7H3/t16-,18+,19?,22?/m1/s1 |
| InChIKey | KTKYJTCZLURNGV-YIJWPKFJSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|