C21H27NO5 — CID 146163469
benzyl 3-[(E)-7-methoxy-7-oxohept-5-enyl]-2-oxopiperidine-1-carboxylate (PubChem CID 146163469) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is benzyl 3-[(E)-7-methoxy-7-oxohept-5-enyl]-2-oxopiperidine-1-carboxylate.
| Compound Name | benzyl 3-[(E)-7-methoxy-7-oxohept-5-enyl]-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 146163469 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | benzyl 3-[(E)-7-methoxy-7-oxohept-5-enyl]-2-oxopiperidine-1-carboxylate |
| SMILES | COC(=O)/C=C/CCCCC1CCCN(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C21H27NO5/c1-26-19(23)14-8-3-2-7-12-18-13-9-15-22(20(18)24)21(25)27-16-17-10-5-4-6-11-17/h4-6,8,10-11,14,18H,2-3,7,9,12-13,15-16H2,1H3/b14-8+ |
| InChIKey | YAJXUBHYIZKYDX-RIYZIHGNSA-N |
| XLogP | 3.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|