C24H39F3O6SSi — CID 146163499
[(2R,3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(3-phenylmethoxypropyl)oxan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 146163499) has the molecular formula C24H39F3O6SSi and a molecular weight of 540.72 g/mol. Its IUPAC name is [(2R,3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(3-phenylmethoxypropyl)oxan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(2R,3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(3-phenylmethoxypropyl)oxan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146163499 |
| Molecular Formula | C24H39F3O6SSi |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | [(2R,3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(3-phenylmethoxypropyl)oxan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COS(=O)(=O)C(F)(F)F)O[C@H]1CCCOCc1ccccc1 |
| InChI | InChI=1S/C24H39F3O6SSi/c1-18-15-21(33-35(5,6)23(2,3)4)22(17-31-34(28,29)24(25,26)27)32-20(18)13-10-14-30-16-19-11-8-7-9-12-19/h7-9,11-12,18,20-22H,10,13-17H2,1-6H3/t18-,20-,21-,22+/m0/s1 |
| InChIKey | QYTOFANUDCUHAV-JKLQHZFJSA-N |
| XLogP | 6.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|