C15H23O3+ — CID 146163623
(2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoic acid (PubChem CID 146163623) has the molecular formula C15H23O3+ and a molecular weight of 251.35 g/mol. Its IUPAC name is (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoic acid.
| Compound Name | (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoic acid |
|---|---|
| PubChem CID | 146163623 |
| Molecular Formula | C15H23O3+ |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoic acid |
| SMILES | CC1=[O+]C=C2[C@@H](CC1)[C@H](C)CC[C@H]2[C@@H](C)C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-9-4-6-13(11(3)15(16)17)14-8-18-10(2)5-7-12(9)14/h8-9,11-13H,4-7H2,1-3H3/p+1/t9-,11-,12+,13+/m1/s1 |
| InChIKey | RRTRJKHSNABFON-XEZLXBQYSA-O |
| XLogP | 3.17 |
| TPSA | 48.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|