C22H25Cl2NS — CID 146163721
1-[(2S,5S)-2-(3,4-dichlorophenyl)-5-(3-methylphenyl)pyrrolidin-1-yl]-2,2-dimethylpropane-1-thione (PubChem CID 146163721) has the molecular formula C22H25Cl2NS and a molecular weight of 406.42 g/mol. Its IUPAC name is 1-[(2S,5S)-2-(3,4-dichlorophenyl)-5-(3-methylphenyl)pyrrolidin-1-yl]-2,2-dimethylpropane-1-thione.
| Compound Name | 1-[(2S,5S)-2-(3,4-dichlorophenyl)-5-(3-methylphenyl)pyrrolidin-1-yl]-2,2-dimethylpropane-1-thione |
|---|---|
| PubChem CID | 146163721 |
| Molecular Formula | C22H25Cl2NS |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-[(2S,5S)-2-(3,4-dichlorophenyl)-5-(3-methylphenyl)pyrrolidin-1-yl]-2,2-dimethylpropane-1-thione |
| SMILES | Cc1cccc([C@@H]2CC[C@@H](c3ccc(Cl)c(Cl)c3)N2C(=S)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H25Cl2NS/c1-14-6-5-7-15(12-14)19-10-11-20(25(19)21(26)22(2,3)4)16-8-9-17(23)18(24)13-16/h5-9,12-13,19-20H,10-11H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | FJHBKUGFMFRCJS-PMACEKPBSA-N |
| XLogP | 7.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|