About tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate
tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate (PubChem CID 146163944) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate |
| PubChem CID | 146163944 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1OC(=O)C[C@@H]1CO |
| InChI | InChI=1S/C10H16O5/c1-10(2,3)15-9(13)8-6(5-11)4-7(12)14-8/h6,8,11H,4-5H2,1-3H3/t6-,8-/m1/s1 |
| InChIKey | PXCJGGGILPYECO-HTRCEHHLSA-N |
| XLogP | 0.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate?
The IUPAC name of tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate (CID 146163944) is tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate.
What is the SMILES notation for tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate?
The canonical SMILES for tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate is CC(C)(C)OC(=O)[C@@H]1OC(=O)C[C@@H]1CO.
What is the InChIKey of tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate?
The InChIKey is PXCJGGGILPYECO-HTRCEHHLSA-N. The full InChI is InChI=1S/C10H16O5/c1-10(2,3)15-9(13)8-6(5-11)4-7(12)14-8/h6,8,11H,4-5H2,1-3H3/t6-,8-/m1/s1.
What are the key properties of tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate?
tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate has a molecular weight of 216.23 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,3R)-3-(hydroxymethyl)-5-oxooxolane-2-carboxylate is sourced from PubChem (CID 146163944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).