About benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate
benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate (PubChem CID 146164140) has the molecular formula C20H33NO4Si
and a molecular weight of 379.57 g/mol. Its IUPAC name is benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate |
| PubChem CID | 146164140 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H33NO4Si/c1-20(2,3)26(4,5)25-17-12-9-13-23-18(17)14-21-19(22)24-15-16-10-7-6-8-11-16/h6-8,10-11,17-18H,9,12-15H2,1-5H3,(H,21,22)/t17-,18+/m0/s1 |
| InChIKey | ONITWWLCDXTROR-ZWKOTPCHSA-N |
| XLogP | 4.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate?
The IUPAC name of benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate (CID 146164140) is benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate.
What is the SMILES notation for benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate?
The canonical SMILES for benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate is CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1CNC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate?
The InChIKey is ONITWWLCDXTROR-ZWKOTPCHSA-N. The full InChI is InChI=1S/C20H33NO4Si/c1-20(2,3)26(4,5)25-17-12-9-13-23-18(17)14-21-19(22)24-15-16-10-7-6-8-11-16/h6-8,10-11,17-18H,9,12-15H2,1-5H3,(H,21,22)/t17-,18+/m0/s1.
What are the key properties of benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate?
benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate has a molecular weight of 379.57 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate is sourced from PubChem (CID 146164140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).