C31H55NO7Si2 — CID 146164263
benzyl (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R)-1-hydroxybut-3-enyl]-4-(methoxymethoxy)pyrrolidine-1-carboxylate (PubChem CID 146164263) has the molecular formula C31H55NO7Si2 and a molecular weight of 609.95 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R)-1-hydroxybut-3-enyl]-4-(methoxymethoxy)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R)-1-hydroxybut-3-enyl]-4-(methoxymethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146164263 |
| Molecular Formula | C31H55NO7Si2 |
| Molecular Weight | 609.95 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | benzyl (2R,3R,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R)-1-hydroxybut-3-enyl]-4-(methoxymethoxy)pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H](O)[C@H]1[C@@H](OCOC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H55NO7Si2/c1-13-17-25(33)26-28(37-22-35-8)27(39-41(11,12)31(5,6)7)24(21-38-40(9,10)30(2,3)4)32(26)29(34)36-20-23-18-15-14-16-19-23/h13-16,18-19,24-28,33H,1,17,20-22H2,2-12H3/t24-,25-,26+,27-,28-/m1/s1 |
| InChIKey | OUOMVQHCOZLFOW-RKFAPSRVSA-N |
| XLogP | 6.71 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.95 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|