C35H43NO5S — CID 146164298
N-[(2R,3R,4R,5R,6R)-2-cyclohexylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 146164298) has the molecular formula C35H43NO5S and a molecular weight of 589.80 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-2-cyclohexylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-2-cyclohexylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 146164298 |
| Molecular Formula | C35H43NO5S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-2-cyclohexylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1SC1CCCCC1 |
| InChI | InChI=1S/C35H43NO5S/c1-26(37)36-32-34(40-24-29-18-10-4-11-19-29)33(39-23-28-16-8-3-9-17-28)31(25-38-22-27-14-6-2-7-15-27)41-35(32)42-30-20-12-5-13-21-30/h2-4,6-11,14-19,30-35H,5,12-13,20-25H2,1H3,(H,36,37)/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | NSJIFAYUORKTSR-CKQPALCZSA-N |
| XLogP | 6.67 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |