C14H12N4O3 — CID 14616443
7-amino-3-methyl-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione (PubChem CID 14616443) has the molecular formula C14H12N4O3 and a molecular weight of 284.27 g/mol. Its IUPAC name is 7-amino-3-methyl-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione.
| Compound Name | 7-amino-3-methyl-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
|---|---|
| PubChem CID | 14616443 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 7-amino-3-methyl-1-phenyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
| SMILES | Cn1c(=O)c2c(=O)cc(N)[nH]c2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C14H12N4O3/c1-17-13(20)11-9(19)7-10(15)16-12(11)18(14(17)21)8-5-3-2-4-6-8/h2-7H,1H3,(H3,15,16,19) |
| InChIKey | QFHPILKKLOOIEE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |