C23H43NOSi2 — CID 146164434
N,N-diethyl-2,6-bis(triethylsilyl)benzamide (PubChem CID 146164434) has the molecular formula C23H43NOSi2 and a molecular weight of 405.78 g/mol. Its IUPAC name is N,N-diethyl-2,6-bis(triethylsilyl)benzamide.
| Compound Name | N,N-diethyl-2,6-bis(triethylsilyl)benzamide |
|---|---|
| PubChem CID | 146164434 |
| Molecular Formula | C23H43NOSi2 |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | N,N-diethyl-2,6-bis(triethylsilyl)benzamide |
| SMILES | CCN(CC)C(=O)c1c([Si](CC)(CC)CC)cccc1[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H43NOSi2/c1-9-24(10-2)23(25)22-20(26(11-3,12-4)13-5)18-17-19-21(22)27(14-6,15-7)16-8/h17-19H,9-16H2,1-8H3 |
| InChIKey | ODFHSMYHALEABN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|