C25H28BNO2S — CID 146164488
6-[1-(1-benzothiophen-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole (PubChem CID 146164488) has the molecular formula C25H28BNO2S and a molecular weight of 417.38 g/mol. Its IUPAC name is 6-[1-(1-benzothiophen-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole.
| Compound Name | 6-[1-(1-benzothiophen-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole |
|---|---|
| PubChem CID | 146164488 |
| Molecular Formula | C25H28BNO2S |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 6-[1-(1-benzothiophen-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole |
| SMILES | CC1(C)OB(CCC(c2ccc3sccc3c2)c2ccc3cc[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C25H28BNO2S/c1-24(2)25(3,4)29-26(28-24)12-9-21(18-7-8-23-20(15-18)11-14-30-23)19-6-5-17-10-13-27-22(17)16-19/h5-8,10-11,13-16,21,27H,9,12H2,1-4H3 |
| InChIKey | KWAPHWDVITYGKA-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|