C15H32OSi2 — CID 146164631
(3S,3aS)-1,3-bis(trimethylsilyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol (PubChem CID 146164631) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is (3S,3aS)-1,3-bis(trimethylsilyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol.
| Compound Name | (3S,3aS)-1,3-bis(trimethylsilyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 146164631 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (3S,3aS)-1,3-bis(trimethylsilyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol |
| SMILES | C[Si](C)(C)C1C(O)[C@@H]([Si](C)(C)C)[C@H]2CCCCC12 |
| InChI | InChI=1S/C15H32OSi2/c1-17(2,3)14-11-9-7-8-10-12(11)15(13(14)16)18(4,5)6/h11-16H,7-10H2,1-6H3/t11-,12?,13?,14-,15?/m0/s1 |
| InChIKey | DHIHGUJWRDVMKA-PJQWEWFWSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|