C12H18O — CID 146164652
(8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol (PubChem CID 146164652) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol.
| Compound Name | (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol |
|---|---|
| PubChem CID | 146164652 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol |
| SMILES | C=C[C@@H](C)CCC(O)C#CC(=C)C |
| InChI | InChI=1S/C12H18O/c1-5-11(4)7-9-12(13)8-6-10(2)3/h5,11-13H,1-2,7,9H2,3-4H3/t11-,12?/m1/s1 |
| InChIKey | UJEXVGFXUVZRHS-JHJMLUEUSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|