About (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol
(8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol (PubChem CID 146164652) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol.
Molecular Properties
| Compound Name | (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol |
| PubChem CID | 146164652 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol |
| SMILES | C=C[C@@H](C)CCC(O)C#CC(=C)C |
| InChI | InChI=1S/C12H18O/c1-5-11(4)7-9-12(13)8-6-10(2)3/h5,11-13H,1-2,7,9H2,3-4H3/t11-,12?/m1/s1 |
| InChIKey | UJEXVGFXUVZRHS-JHJMLUEUSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol?
The IUPAC name of (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol (CID 146164652) is (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol.
What is the SMILES notation for (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol?
The canonical SMILES for (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol is C=C[C@@H](C)CCC(O)C#CC(=C)C.
What is the InChIKey of (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol?
The InChIKey is UJEXVGFXUVZRHS-JHJMLUEUSA-N. The full InChI is InChI=1S/C12H18O/c1-5-11(4)7-9-12(13)8-6-10(2)3/h5,11-13H,1-2,7,9H2,3-4H3/t11-,12?/m1/s1.
What are the key properties of (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol?
(8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol has a molecular weight of 178.27 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-2,8-dimethyldeca-1,9-dien-3-yn-5-ol is sourced from PubChem (CID 146164652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).