About (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one
(Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one (PubChem CID 146165005) has the molecular formula C18H16Cl2O2S
and a molecular weight of 367.30 g/mol. Its IUPAC name is (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one |
| PubChem CID | 146165005 |
| Molecular Formula | C18H16Cl2O2S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one |
| SMILES | CS(C)(=O)=C/C(=C\C(=O)c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H16Cl2O2S/c1-23(2,22)12-14(13-6-4-3-5-7-13)10-18(21)16-9-8-15(19)11-17(16)20/h3-12H,1-2H3/b14-10+ |
| InChIKey | NRUSFBZFFPDENY-GXDHUFHOSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one?
The IUPAC name of (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one (CID 146165005) is (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one.
What is the SMILES notation for (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one?
The canonical SMILES for (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one is CS(C)(=O)=C/C(=C\C(=O)c1ccc(Cl)cc1Cl)c1ccccc1.
What is the InChIKey of (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one?
The InChIKey is NRUSFBZFFPDENY-GXDHUFHOSA-N. The full InChI is InChI=1S/C18H16Cl2O2S/c1-23(2,22)12-14(13-6-4-3-5-7-13)10-18(21)16-9-8-15(19)11-17(16)20/h3-12H,1-2H3/b14-10+.
What are the key properties of (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one?
(Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one has a molecular weight of 367.30 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(2,4-dichlorophenyl)-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-phenylbut-2-en-1-one is sourced from PubChem (CID 146165005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).