C15H16F3NO3 — CID 146165022
ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-[(3-methyl-1H-indol-2-yl)methyl]propanoate (PubChem CID 146165022) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-[(3-methyl-1H-indol-2-yl)methyl]propanoate.
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-[(3-methyl-1H-indol-2-yl)methyl]propanoate |
|---|---|
| PubChem CID | 146165022 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-hydroxy-2-[(3-methyl-1H-indol-2-yl)methyl]propanoate |
| SMILES | CCOC(=O)[C@](O)(Cc1[nH]c2ccccc2c1C)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO3/c1-3-22-13(20)14(21,15(16,17)18)8-12-9(2)10-6-4-5-7-11(10)19-12/h4-7,19,21H,3,8H2,1-2H3/t14-/m1/s1 |
| InChIKey | ILDCGKUQLCTODG-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|