About (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide
(2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide (PubChem CID 146165236) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide.
Molecular Properties
| Compound Name | (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide |
| PubChem CID | 146165236 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide |
| SMILES | CCC[C@@H](C(=O)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO/c1-4-5-6(8(9,10)11)7(13)12(2)3/h6H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | JXAXCRPKSIRZKF-LURJTMIESA-N |
| XLogP | 2.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide?
The IUPAC name of (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide (CID 146165236) is (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide.
What is the SMILES notation for (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide?
The canonical SMILES for (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide is CCC[C@@H](C(=O)N(C)C)C(F)(F)F.
What is the InChIKey of (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide?
The InChIKey is JXAXCRPKSIRZKF-LURJTMIESA-N. The full InChI is InChI=1S/C8H14F3NO/c1-4-5-6(8(9,10)11)7(13)12(2)3/h6H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide?
(2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide has a molecular weight of 197.20 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dimethyl-2-(trifluoromethyl)pentanamide is sourced from PubChem (CID 146165236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).