C17H22F3NO2 — CID 146165267
tert-butyl N-[(2R)-1-[3-(trifluoromethyl)phenyl]pent-4-en-2-yl]carbamate (PubChem CID 146165267) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[3-(trifluoromethyl)phenyl]pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[3-(trifluoromethyl)phenyl]pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 146165267 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | tert-butyl N-[(2R)-1-[3-(trifluoromethyl)phenyl]pent-4-en-2-yl]carbamate |
| SMILES | C=CC[C@H](Cc1cccc(C(F)(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22F3NO2/c1-5-7-14(21-15(22)23-16(2,3)4)11-12-8-6-9-13(10-12)17(18,19)20/h5-6,8-10,14H,1,7,11H2,2-4H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | FFMHUDFGFPOFIX-CQSZACIVSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|