C21H28F3NO6Se — CID 146165397
methyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]selanylpropanoate (PubChem CID 146165397) has the molecular formula C21H28F3NO6Se and a molecular weight of 526.41 g/mol. Its IUPAC name is methyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]selanylpropanoate.
| Compound Name | methyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]selanylpropanoate |
|---|---|
| PubChem CID | 146165397 |
| Molecular Formula | C21H28F3NO6Se |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | methyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]selanylpropanoate |
| SMILES | COC(=O)[C@H](C[Se]c1cccc(C(F)(F)F)c1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28F3NO6Se/c1-19(2,3)30-17(27)25(18(28)31-20(4,5)6)15(16(26)29-7)12-32-14-10-8-9-13(11-14)21(22,23)24/h8-11,15H,12H2,1-7H3/t15-/m0/s1 |
| InChIKey | WEHAOIHOYJDXRO-HNNXBMFYSA-N |
| XLogP | 4.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|