C14H28N2O2 — CID 146165647
N,N'-bis[(2S)-1-(1,2,2-trideuterioethenoxy)butan-2-yl]ethane-1,2-diamine (PubChem CID 146165647) has the molecular formula C14H28N2O2 and a molecular weight of 262.43 g/mol. Its IUPAC name is N,N'-bis[(2S)-1-(1,2,2-trideuterioethenoxy)butan-2-yl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[(2S)-1-(1,2,2-trideuterioethenoxy)butan-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 146165647 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | N,N'-bis[(2S)-1-(1,2,2-trideuterioethenoxy)butan-2-yl]ethane-1,2-diamine |
| SMILES | [2H]C([2H])=C([2H])OC[C@H](CC)NCCN[C@@H](CC)COC([2H])=C([2H])[2H] |
| InChI | InChI=1S/C14H28N2O2/c1-5-13(11-17-7-3)15-9-10-16-14(6-2)12-18-8-4/h7-8,13-16H,3-6,9-12H2,1-2H3/t13-,14-/m0/s1/i3D2,4D2,7D,8D |
| InChIKey | PMOKSEKDNHVWLB-VXGYKMEBSA-N |
| XLogP | 2.04 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|