About 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole
1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole (PubChem CID 146165678) has the molecular formula C12H10FNS
and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole.
Molecular Properties
| Compound Name | 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole |
| PubChem CID | 146165678 |
| Molecular Formula | C12H10FNS |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole |
| SMILES | CCc1csc2cc3cc(F)ccc3n12 |
| InChI | InChI=1S/C12H10FNS/c1-2-10-7-15-12-6-8-5-9(13)3-4-11(8)14(10)12/h3-7H,2H2,1H3 |
| InChIKey | PXOBFWNQONRMBX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole?
The IUPAC name of 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole (CID 146165678) is 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole.
What is the SMILES notation for 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole?
The canonical SMILES for 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole is CCc1csc2cc3cc(F)ccc3n12.
What is the InChIKey of 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole?
The InChIKey is PXOBFWNQONRMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNS/c1-2-10-7-15-12-6-8-5-9(13)3-4-11(8)14(10)12/h3-7H,2H2,1H3.
What are the key properties of 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole?
1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole has a molecular weight of 219.28 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-fluoro-[1,3]thiazolo[3,2-a]indole is sourced from PubChem (CID 146165678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).