C31H34FNO7Se — CID 146165714
(3R,4S,5R,6R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-selenoxanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 146165714) has the molecular formula C31H34FNO7Se and a molecular weight of 630.57 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-selenoxanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-selenoxanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146165714 |
| Molecular Formula | C31H34FNO7Se |
| Molecular Weight | 630.57 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | (3R,4S,5R,6R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-selenoxanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCN(CC)c1ccc2c(c1)[Se]c1c(ccc(OC3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c1CF)C21OCc2ccccc21 |
| InChI | InChI=1S/C31H34FNO7Se/c1-3-33(4-2)18-9-10-21-25(13-18)41-29-19(14-32)23(39-30-28(37)27(36)26(35)24(15-34)40-30)12-11-22(29)31(21)20-8-6-5-7-17(20)16-38-31/h5-13,24,26-28,30,34-37H,3-4,14-16H2,1-2H3/t24-,26+,27+,28-,30?,31?/m1/s1 |
| InChIKey | XIRKSTOPIASALD-KNYFVTFUSA-N |
| XLogP | 0.97 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|