About 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide
3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide (PubChem CID 146165740) has the molecular formula C18H24N2O2S
and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide |
| PubChem CID | 146165740 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide |
| SMILES | Cc1nn(C2CCS(=O)(=O)C2)c(C)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-12(2)15-5-7-16(8-6-15)18-13(3)19-20(14(18)4)17-9-10-23(21,22)11-17/h5-8,12,17H,9-11H2,1-4H3 |
| InChIKey | APPRHTNAMZRTQL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide?
The IUPAC name of 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide (CID 146165740) is 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide is Cc1nn(C2CCS(=O)(=O)C2)c(C)c1-c1ccc(C(C)C)cc1.
What is the InChIKey of 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide?
The InChIKey is APPRHTNAMZRTQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2S/c1-12(2)15-5-7-16(8-6-15)18-13(3)19-20(14(18)4)17-9-10-23(21,22)11-17/h5-8,12,17H,9-11H2,1-4H3.
What are the key properties of 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide?
3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide has a molecular weight of 332.47 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dimethyl-4-(4-propan-2-ylphenyl)pyrazol-1-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 146165740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).