C10H19BO3 — CID 146165741
[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol (PubChem CID 146165741) has the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. Its IUPAC name is [(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 146165741 |
| Molecular Formula | C10H19BO3 |
| Molecular Weight | 198.07 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methanol |
| SMILES | CC1(C)OB([C@@H]2C[C@H]2CO)OC1(C)C |
| InChI | InChI=1S/C10H19BO3/c1-9(2)10(3,4)14-11(13-9)8-5-7(8)6-12/h7-8,12H,5-6H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | MDHNDTVRXDFFEA-JGVFFNPUSA-N |
| XLogP | 1.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.07 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|