About 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole
6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole (PubChem CID 146165790) has the molecular formula C13H12FNS
and a molecular weight of 233.31 g/mol. Its IUPAC name is 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole.
Molecular Properties
| Compound Name | 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole |
| PubChem CID | 146165790 |
| Molecular Formula | C13H12FNS |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole |
| SMILES | CCCc1csc2cc3cc(F)ccc3n12 |
| InChI | InChI=1S/C13H12FNS/c1-2-3-11-8-16-13-7-9-6-10(14)4-5-12(9)15(11)13/h4-8H,2-3H2,1H3 |
| InChIKey | ZIKXVWLUQIKQQQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole?
The IUPAC name of 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole (CID 146165790) is 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole.
What is the SMILES notation for 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole?
The canonical SMILES for 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole is CCCc1csc2cc3cc(F)ccc3n12.
What is the InChIKey of 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole?
The InChIKey is ZIKXVWLUQIKQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNS/c1-2-3-11-8-16-13-7-9-6-10(14)4-5-12(9)15(11)13/h4-8H,2-3H2,1H3.
What are the key properties of 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole?
6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole has a molecular weight of 233.31 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-propyl-[1,3]thiazolo[3,2-a]indole is sourced from PubChem (CID 146165790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).