C22H22INO5 — CID 146165886
1-O-tert-butyl 2-O-(2-iodo-5-methoxyphenyl) 3-methylindole-1,2-dicarboxylate (PubChem CID 146165886) has the molecular formula C22H22INO5 and a molecular weight of 507.32 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(2-iodo-5-methoxyphenyl) 3-methylindole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(2-iodo-5-methoxyphenyl) 3-methylindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 146165886 |
| Molecular Formula | C22H22INO5 |
| Molecular Weight | 507.32 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 1-O-tert-butyl 2-O-(2-iodo-5-methoxyphenyl) 3-methylindole-1,2-dicarboxylate |
| SMILES | COc1ccc(I)c(OC(=O)c2c(C)c3ccccc3n2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H22INO5/c1-13-15-8-6-7-9-17(15)24(21(26)29-22(2,3)4)19(13)20(25)28-18-12-14(27-5)10-11-16(18)23/h6-12H,1-5H3 |
| InChIKey | WSYFFAGVIFSFPK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|