C8H10N2O — CID 146166086
[(1R)-2-pyrimidin-5-ylcyclopropyl]methanol (PubChem CID 146166086) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is [(1R)-2-pyrimidin-5-ylcyclopropyl]methanol.
| Compound Name | [(1R)-2-pyrimidin-5-ylcyclopropyl]methanol |
|---|---|
| PubChem CID | 146166086 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | [(1R)-2-pyrimidin-5-ylcyclopropyl]methanol |
| SMILES | OC[C@@H]1CC1c1cncnc1 |
| InChI | InChI=1S/C8H10N2O/c11-4-6-1-8(6)7-2-9-5-10-3-7/h2-3,5-6,8,11H,1,4H2/t6-,8?/m0/s1 |
| InChIKey | RMEBMGFXQWIADB-UUEFVBAFSA-N |
| XLogP | 0.57 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |