C19H18NO3Pd- — CID 146166147
acetic acid;(10bS)-10b,11-dimethylisoindolo[2,1-a]indol-11-id-6-one;palladium (PubChem CID 146166147) has the molecular formula C19H18NO3Pd- and a molecular weight of 414.78 g/mol. Its IUPAC name is acetic acid;(10bS)-10b,11-dimethylisoindolo[2,1-a]indol-11-id-6-one;palladium.
| Compound Name | acetic acid;(10bS)-10b,11-dimethylisoindolo[2,1-a]indol-11-id-6-one;palladium |
|---|---|
| PubChem CID | 146166147 |
| Molecular Formula | C19H18NO3Pd- |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | acetic acid;(10bS)-10b,11-dimethylisoindolo[2,1-a]indol-11-id-6-one;palladium |
| SMILES | CC(=O)O.C[C-]1c2ccccc2N2C(=O)c3ccccc3[C@]12C.[Pd] |
| InChI | InChI=1S/C17H14NO.C2H4O2.Pd/c1-11-12-7-4-6-10-15(12)18-16(19)13-8-3-5-9-14(13)17(11,18)2;1-2(3)4;/h3-10H,1-2H3;1H3,(H,3,4);/q-1;;/t17-;;/m0../s1 |
| InChIKey | MUVMHXZDRFHPJB-RMRYJAPISA-N |
| XLogP | 3.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|