About [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol
[(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol (PubChem CID 146166172) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol |
| PubChem CID | 146166172 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol |
| SMILES | Cc1ccnc([C@@H]2C[C@H]2CO)c1 |
| InChI | InChI=1S/C10H13NO/c1-7-2-3-11-10(4-7)9-5-8(9)6-12/h2-4,8-9,12H,5-6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | FOEVTZQJKLLPPG-DTWKUNHWSA-N |
| XLogP | 1.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol?
The IUPAC name of [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol (CID 146166172) is [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol.
What is the SMILES notation for [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol?
The canonical SMILES for [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol is Cc1ccnc([C@@H]2C[C@H]2CO)c1.
What is the InChIKey of [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol?
The InChIKey is FOEVTZQJKLLPPG-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H13NO/c1-7-2-3-11-10(4-7)9-5-8(9)6-12/h2-4,8-9,12H,5-6H2,1H3/t8-,9+/m0/s1.
What are the key properties of [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol?
[(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol has a molecular weight of 163.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(4-methyl-2-pyridinyl)cyclopropyl]methanol is sourced from PubChem (CID 146166172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).