About 2-chloro-3-iodoquinoline
2-chloro-3-iodoquinoline (PubChem CID 14616623) has the molecular formula C9H5ClIN
and a molecular weight of 289.50 g/mol. Its IUPAC name is 2-chloro-3-iodoquinoline.
Molecular Properties
| Compound Name | 2-chloro-3-iodoquinoline |
| PubChem CID | 14616623 |
| Molecular Formula | C9H5ClIN |
| Molecular Weight | 289.50 g/mol |
| Exact Mass | 288.92 |
| IUPAC Name | 2-chloro-3-iodoquinoline |
| SMILES | Clc1nc2ccccc2cc1I |
| InChI | InChI=1S/C9H5ClIN/c10-9-7(11)5-6-3-1-2-4-8(6)12-9/h1-5H |
| InChIKey | VAKSSUOSONRGPR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-iodoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-iodoquinoline?
The IUPAC name of 2-chloro-3-iodoquinoline (CID 14616623) is 2-chloro-3-iodoquinoline.
What is the SMILES notation for 2-chloro-3-iodoquinoline?
The canonical SMILES for 2-chloro-3-iodoquinoline is Clc1nc2ccccc2cc1I.
What is the InChIKey of 2-chloro-3-iodoquinoline?
The InChIKey is VAKSSUOSONRGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClIN/c10-9-7(11)5-6-3-1-2-4-8(6)12-9/h1-5H.
What are the key properties of 2-chloro-3-iodoquinoline?
2-chloro-3-iodoquinoline has a molecular weight of 289.50 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-iodoquinoline is sourced from PubChem (CID 14616623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).