C8H15N3O4 — CID 146166683
(1Z,5R,6R,7R)-1-hydroxyimino-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazine-6,7-diol (PubChem CID 146166683) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is (1Z,5R,6R,7R)-1-hydroxyimino-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazine-6,7-diol.
| Compound Name | (1Z,5R,6R,7R)-1-hydroxyimino-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazine-6,7-diol |
|---|---|
| PubChem CID | 146166683 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1Z,5R,6R,7R)-1-hydroxyimino-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazine-6,7-diol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)CN2/C(=N\O)CCN12 |
| InChI | InChI=1S/C8H15N3O4/c12-4-5-8(14)6(13)3-11-7(9-15)1-2-10(5)11/h5-6,8,12-15H,1-4H2/b9-7-/t5-,6-,8-/m1/s1 |
| InChIKey | BCYJFUWQICNGDH-VTHWHGGASA-N |
| XLogP | -2.21 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|