C24H39NO6 — CID 146166700
(2R,3R,4S,5S,6S,8R,10R,13S,16S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8-diol (PubChem CID 146166700) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S,8R,10R,13S,16S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8-diol.
| Compound Name | (2R,3R,4S,5S,6S,8R,10R,13S,16S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8-diol |
|---|---|
| PubChem CID | 146166700 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (2R,3R,4S,5S,6S,8R,10R,13S,16S,17R,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8-diol |
| SMILES | COC[C@@]12CCC(OC)C34[C@@H]5C[C@H]6[C@H](O)[C@@H]5[C@](O)(C[C@@H]6OC)C(C(OC)[C@@H]31)[C@H]4N(C)C2 |
| InChI | InChI=1S/C24H39NO6/c1-25-10-22(11-28-2)7-6-15(30-4)24-13-8-12-14(29-3)9-23(27,16(13)18(12)26)17(21(24)25)19(31-5)20(22)24/h12-21,26-27H,6-11H2,1-5H3/t12-,13-,14+,15?,16-,17?,18+,19?,20-,21-,22+,23-,24?/m1/s1 |
| InChIKey | TYYWGCFPDCCBFN-SCLGDYBXSA-N |
| XLogP | 0.77 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |