C31H54O3Si — CID 146166912
[(1R)-1-[(4aR,6S,8aS)-2,5,5,8a-tetramethyl-6-tri(propan-2-yl)silyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]prop-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 146166912) has the molecular formula C31H54O3Si and a molecular weight of 502.86 g/mol. Its IUPAC name is [(1R)-1-[(4aR,6S,8aS)-2,5,5,8a-tetramethyl-6-tri(propan-2-yl)silyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]prop-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R)-1-[(4aR,6S,8aS)-2,5,5,8a-tetramethyl-6-tri(propan-2-yl)silyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]prop-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146166912 |
| Molecular Formula | C31H54O3Si |
| Molecular Weight | 502.86 g/mol |
| Exact Mass | 502.38 |
| IUPAC Name | [(1R)-1-[(4aR,6S,8aS)-2,5,5,8a-tetramethyl-6-tri(propan-2-yl)silyloxy-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]prop-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#C[C@@H](OC(=O)C(C)(C)C)C1=C(C)CC[C@H]2C(C)(C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@]12C |
| InChI | InChI=1S/C31H54O3Si/c1-15-24(33-28(32)29(9,10)11)27-23(8)16-17-25-30(12,13)26(18-19-31(25,27)14)34-35(20(2)3,21(4)5)22(6)7/h1,20-22,24-26H,16-19H2,2-14H3/t24-,25+,26+,31+/m1/s1 |
| InChIKey | GNCAOOILJYTWRB-OLHJXYGRSA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.86 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|